For research use only. Not for therapeutic Use.
3-(2-Hydroxyethyl)pyrrolidin-2-one(CAT: L032175) is a heterocyclic compound featuring a pyrrolidin-2-one (lactam) ring with a hydroxyethyl group at the 3-position. This compound is commonly used in organic synthesis and medicinal chemistry as a building block for developing more complex molecules. The presence of both a lactam and a hydroxyl group provides sites for further functionalization, making it valuable in the synthesis of bioactive molecules, such as pharmaceuticals and agrochemicals. 3-(2-Hydroxyethyl)pyrrolidin-2-one is often employed in the design of compounds that may target neurological, anti-inflammatory, or metabolic pathways, where its structural features contribute to improved solubility and bioavailability in therapeutic applications.
CAS Number | 932-47-8 |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
IUPAC Name | 3-(2-hydroxyethyl)pyrrolidin-2-one |
InChI | InChI=1S/C6H11NO2/c8-4-2-5-1-3-7-6(5)9/h5,8H,1-4H2,(H,7,9) |
InChIKey | UJYRIMZFBRGKQF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |