For research use only. Not for therapeutic Use.
3-Thiopheneboronic acid(Cat No.:R025019)is an organoboron compound consisting of a thiophene ring (a sulfur-containing five-membered heterocycle) bonded to a boronic acid group at the 3-position. It is widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it facilitates the formation of carbon-carbon bonds with various aryl or alkyl halides. The boronic acid group also makes it useful in the design of materials, drug discovery, and sensor technology. This compound can enhance the solubility and stability of certain molecules, and its thiophene ring imparts electronic properties useful in electronic and optoelectronic applications.
| CAS Number | 6165-69-1 |
| Synonyms | 3-Thienyl-boronic Acid; (Thiophene-3-yl)boronic Acid; 3-Thienylboronic Acid; 3-Thiopheneboric Acid; 3-Thiophenylboronic Acid; Thiophen-3-boronic Acid; Thiophen-3-ylboronic Acid |
| Molecular Formula | C4H5BO2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | thiophen-3-ylboronic acid |
| InChI | InChI=1S/C4H5BO2S/c6-5(7)4-1-2-8-3-4/h1-3,6-7H |
| InChIKey | QNMBSXGYAQZCTN-UHFFFAOYSA-N |
| SMILES | B(C1=CSC=C1)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |