For research use only. Not for therapeutic Use.
3′-O-Methylcytidine(Cat No.:I041245)is a modified nucleoside where a methyl group is attached to the 3′-hydroxyl group of the ribose sugar in cytidine. This modification enhances the stability and resistance of RNA molecules containing 3′-O-methylcytidine to enzymatic degradation, making it useful in RNA-based research and therapeutic applications. It is often incorporated into RNA sequences in studies investigating RNA stability, translation efficiency, and gene regulation. Researchers also explore its potential role in RNA modification and its use in RNA therapeutics, such as improving the performance of RNA vaccines or gene therapies.
CAS Number | 20594-00-7 |
Synonyms | 4-amino-1-[(2R,3S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one |
Molecular Formula | C10H15N3O5 |
Purity | ≥95% |
IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]pyrimidin-2-one |
InChI | InChI=1S/C10H15N3O5/c1-17-8-5(4-14)18-9(7(8)15)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,9-/m1/s1 Create Date: 2007-12-04 |
InChIKey | RZJCFLSPBDUNDH-ZOQUXTDFSA-N |
SMILES | CO[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=CC(=NC2=O)N)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |