Home
>
Reference Standards>Organic Building Blocks>Buliding Block Chemicals> 3,4-Dimethoxybenzoic Acid (Veratric Acid)
For research use only. Not for therapeutic Use.
3,4-Dimethoxybenzoic acid(CAT: R046203), also known as veratric acid, is an aromatic carboxylic acid featuring methoxy groups at the 3- and 4-positions of the benzene ring and a carboxyl group at position 1. Naturally occurring in various plants, veratric acid is known for its antioxidant, anti-inflammatory, and antimicrobial properties, making it a subject of interest in pharmacological and nutraceutical research. It also serves as a synthetic intermediate in the production of dyes, fragrances, and bioactive compounds. Its phenolic ether structure enhances chemical stability and lipophilicity.
CAS Number | 93-07-2 |
Synonyms | Dimethylprotocatechuic acid; NSC 7721; |
Molecular Formula | C9H10O4 |
Purity | ≥95% |
Target | NF-κB |
Storage | 3 years -20C powder |
IUPAC Name | 3,4-dimethoxybenzoic acid |
InChI | InChI=1S/C9H10O4/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3,(H,10,11) |
InChIKey | DAUAQNGYDSHRET-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C(=O)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |