Home
>
Bioactive Chemicals>Amino acids> (2S,4S)-Methyl 4-(((benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylate dihydrochloride
For research use only. Not for therapeutic Use.
(2S,4S)-Methyl 4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylate dihydrochloride is a stereochemically defined compound used in organic synthesis and pharmaceutical research. It features a protected pyrrolidine core with a benzyloxycarbonyl (Cbz) group, commonly employed to shield amine groups during peptide synthesis. The methyl ester and dihydrochloride salt enhance its stability and solubility, making it useful for further modifications. This compound is particularly valuable in the development of peptidomimetics and drug candidates, where stereochemistry is crucial for biological activity.
| CAS Number | 1279038-33-3 |
| Molecular Formula | C14H20Cl2N2O4 |
| Purity | ≥95% |
| IUPAC Name | methyl (2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylate;dihydrochloride |
| InChI | InChI=1S/C14H18N2O4.2ClH/c1-19-13(17)12-7-11(8-15-12)16-14(18)20-9-10-5-3-2-4-6-10;;/h2-6,11-12,15H,7-9H2,1H3,(H,16,18);2*1H/t11-,12-;;/m0../s1 |
| InChIKey | HQUSUWARFWJKPL-AQEKLAMFSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |