Home
>
Reference Standards> [(2R,5R)-5-[(2-aminoacetyl)amino]-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid
For research use only. Not for therapeutic Use.
[(2R,5R)-5-[(2-aminoacetyl)amino]-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid(Cat No.:M121587) is a complex chemical compound. It is a phosphonic acid derivative containing a sugar moiety and an amino acid component. This compound is a key intermediate in the synthesis of nucleotide analogs and phosphonate-containing compounds with potential pharmaceutical applications. It mimics the structure of nucleoside triphosphates and is used in the development of antiviral and anticancer drugs. The compound’s structure allows it to interfere with nucleic acid synthesis in target cells, making it a promising candidate for further research and drug development.
| CAS Number | 10074-18-7 |
| Molecular Formula | C7H15N2O8P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(2R,3S,4R,5R)-5-[(2-aminoacetyl)amino]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI | InChI=1S/C7H15N2O8P/c8-1-4(10)9-7-6(12)5(11)3(17-7)2-16-18(13,14)15/h3,5-7,11-12H,1-2,8H2,(H,9,10)(H2,13,14,15)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | OBQMLSFOUZUIOB-SHUUEZRQSA-N |
| SMILES | C(C1C(C(C(O1)NC(=O)CN)O)O)OP(=O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |