For research use only. Not for therapeutic Use.
(2R,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid is a chiral amino acid derivative with a complex bicyclic structure. It is important in the synthesis of pharmaceuticals and bioactive compounds. Its unique stereochemistry makes it valuable for creating molecules with specific biological activities, aiding in the development of drugs targeting various medical conditions, including neurological disorders and infections.
CAS Number | 145438-95-5 |
Synonyms | [2R-(2α,3aβ,7aα)]-Octahydro-1H-Indole-2-carboxylic Acid |
Molecular Formula | C9H15NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
InChI | InChI=1S/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7+,8-/m1/s1 |
InChIKey | CQYBNXGHMBNGCG-GJMOJQLCSA-N |
SMILES | C1CCC2C(C1)CC(N2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |