For research use only. Not for therapeutic Use.
(2R,2’R)-4,4′-Disulfanediylbis(2-aminobutanoic acid)(Cat No.:R015967)is a disulfide-linked L-homocysteine dimer, playing a crucial role in biochemical and pharmaceutical research. Its disulfide bond mimics cystine, making it valuable in peptide synthesis, protein engineering, and redox biology studies. As a precursor for modified peptides and thiol-containing biomolecules, it contributes to structural stability and functional modulation in proteins. This compound is particularly useful in drug discovery, enzymatic research, and metabolic studies, where sulfur-containing amino acids impact protein folding, cellular signaling, and redox homeostasis, making it essential in biochemical and medicinal applications.
CAS Number | 6027-15-2 |
Synonyms | (2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid |
Molecular Formula | C8H16N2O4S2 |
Purity | ≥95% |
IUPAC Name | (2R)-2-amino-4-[[(3R)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid |
InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m1/s1 |
InChIKey | ZTVZLYBCZNMWCF-PHDIDXHHSA-N |
SMILES | C(CSSCC[C@H](C(=O)O)N)[C@H](C(=O)O)N |