For research use only. Not for therapeutic Use.
2H-Pyrido[4,3-b]-1,4-oxazin-3(4H)-one is a heterocyclic compound characterized by a fused pyridine and oxazine ring system. This structure features a carbonyl group in the oxazine, contributing to its reactivity and potential biological activity. The compound is of interest in medicinal chemistry due to its unique molecular framework, which may exhibit antimicrobial or anticancer properties. Its ability to participate in various chemical reactions makes it a valuable intermediate in the synthesis of pharmaceuticals and other bioactive compounds.
| CAS Number | 102226-40-4 |
| Molecular Formula | C7H6N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4H-pyrido[4,3-b][1,4]oxazin-3-one |
| InChI | InChI=1S/C7H6N2O2/c10-7-4-11-6-1-2-8-3-5(6)9-7/h1-3H,4H2,(H,9,10) |
| InChIKey | GMGNQLIBKSJBQC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CN=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |