For research use only. Not for therapeutic Use.
2H-Benzotriazole-5-carboxylic acid (Cat No.:M029579) is a chemical compound. It consists of a benzotriazole core substituted with a carboxylic acid group. This compound is significant in corrosion inhibition, particularly for metals like copper and its alloys. It forms a protective layer on metal surfaces, preventing their degradation due to oxidation and corrosion. Its role in inhibiting metal corrosion contributes to its importance in industrial applications, including the protection of materials in various environments. This compound supports the development of effective strategies for maintaining the integrity and longevity of metal-based products.
CAS Number | 23814-12-2 |
Molecular Formula | C7H5N3O2 |
Purity | ≥95% |
Storage | Inert atmosphere,Room Temperature |
IUPAC Name | 2H-benzotriazole-5-carboxylic acid |
InChI | InChI=1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) |
InChIKey | GUOVBFFLXKJFEE-UHFFFAOYSA-N |
SMILES | C1=CC2=NNN=C2C=C1C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |