For research use only. Not for therapeutic Use.
2H-1,4-Benzoxazine-2,3(4H)-dione(CAT: L014890) is a high-purity heterocyclic compound featuring a benzoxazine core with a dione functionality, making it a valuable intermediate in pharmaceutical and fine chemical research. Its unique structure allows for versatile applications in the synthesis of bioactive molecules, small-molecule inhibitors, and advanced organic materials. Known for its stability and reactivity, this compound supports the development of complex heterocycles, particularly in medicinal chemistry and material science. 2H-1,4-Benzoxazine-2,3(4H)-dione is ideal for precision synthesis, enabling efficient pathways for innovative drug discovery, agrochemical development, and specialty chemical production in both academic and industrial settings.
CAS Number | 3597-63-5 |
Molecular Formula | C8H5NO3 |
Purity | ≥95% |
IUPAC Name | 4H-1,4-benzoxazine-2,3-dione |
InChI | InChI=1S/C8H5NO3/c10-7-8(11)12-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,10) |
InChIKey | MNDKNFRJYMSGTH-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=O)C(=O)O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |