For research use only. Not for therapeutic Use.
2F-Peracetyl-Fucose(Cat No.:R024636)is a fucosylated carbohydrate derivative, where the fucose sugar is modified with acetyl groups at the hydroxyl positions. This compound is often used in carbohydrate chemistry and glycoscience research to study glycosylation processes, glycan-protein interactions, and to explore its potential in developing glycomimetics. The acetylation of fucose enhances its stability and solubility, making it a useful tool for applications in drug development, particularly in the synthesis of carbohydrate-based drug candidates or as part of glycoconjugates in immunology and cancer research. Its structural modifications also offer insights into fucose-related biological activities.
| CAS Number | 188783-78-0 |
| Synonyms | [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate |
| Molecular Formula | C12H17FO7 |
| Purity | ≥95% |
| IUPAC Name | [(2S,3R,4R,5S)-4,6-diacetyloxy-5-fluoro-2-methyloxan-3-yl] acetate |
| InChI | InChI=1S/C12H17FO7/c1-5-10(18-6(2)14)11(19-7(3)15)9(13)12(17-5)20-8(4)16/h5,9-12H,1-4H3/t5-,9-,10+,11-,12?/m0/s1 |
| InChIKey | QFVJLBVULJFLKN-VLCHEQJQSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |