Home
>
Chemical Reagents>Organic Building Blocks>
>
(2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid
For research use only, not for therapeutic use.
(2E)-2-(Acetylhydrazinylidene)-2-phenylacetic acid(Cat No.:L003241)is a high-purity compound commonly used in pharmaceutical and chemical research. This molecule features an acetylhydrazinylidene group linked to a phenylacetic acid core, with a double bond in the (2E) configuration. It serves as a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, such as condensation and coupling reactions. (2E)-2-(Acetylhydrazinylidene)-2-phenylacetic acid is essential for precise synthetic applications in medicinal chemistry.
Catalog Number | L003241 |
CAS Number | 97509-70-1 |
Molecular Formula | C10H10N2O3 |
Purity | ≥95% |
IUPAC Name | (2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid |
InChI | InChI=1S/C10H10N2O3/c1-7(13)11-12-9(10(14)15)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,13)(H,14,15)/b12-9+ |
InChIKey | FINCVADLYATHML-FMIVXFBMSA-N |
SMILES | CC(=O)NN=C(C1=CC=CC=C1)C(=O)O |