Home
>
Materials Science>Organic Optoelectronic Materials>Electron Transport Materials/Hole Blocking Materials> 2.9-Dimethyl-4.7-diphenyl-1.10-phenanthroline
For research use only. Not for therapeutic Use.
2,9-Dimethyl-4,7-diphenyl-1,10-phenanthroline(CAT: R070533) (commonly abbreviated as BCP or bathocuproine) is an organic heteroaromatic ligand widely used in coordination chemistry and optoelectronic research. Its rigid phenanthroline backbone, substituted with methyl and phenyl groups, enhances planarity, electron-transport properties, and photostability. BCP plays a critical role as an electron-transport and hole-blocking material in organic light-emitting diodes (OLEDs) and photovoltaic devices, where it improves efficiency and lifetime. In coordination chemistry, it forms stable complexes with transition metals, making it valuable for catalysis, luminescent probes, and electrochemical studies. Its dual utility in materials science and fundamental research underscores its broad scientific importance.
| CAS Number | 4733-39-5 |
| Synonyms | Bathocuproine |
| Molecular Formula | C26H20N2 |
| Purity | ≥95% |
| Documentation | |
| Storage | Room Temperature (Recommended in a cool and dark place) |
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChI | InChI=1S/C26H20N2/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17/h3-16H,1-2H3 |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)C4=CC=CC=C4)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |