For research use only. Not for therapeutic Use.
2,8-Dinitrodibenzothiophene(Cat No.:M010075) is a chemically synthesized aromatic compound characterized by a dibenzothiophene core, which is a sulfur-containing three-ring system, modified by the addition of nitro groups at the 2 and 8 positions. The presence of nitro groups introduces significant electron-withdrawing effects, enhancing the compound’s reactivity. This molecule is of interest primarily in material science and organic chemistry for its potential use in creating novel organic semiconductors and conducting materials. The unique structure of 2,8-dinitrodibenzothiophene, incorporating both sulfur and nitro functionalities, could also make it useful in advanced polymer synthesis and as an intermediate in chemical synthesis.
| CAS Number | 109041-38-5 |
| Synonyms | 2,8-DINITRODIBENZOTHIOPHENE (100UG/ML IN TOLUENE) |
| Molecular Formula | C12H6N2O4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,8-dinitrodibenzothiophene |
| InChI | InChI=1S/C12H6N2O4S/c15-13(16)7-1-3-11-9(5-7)10-6-8(14(17)18)2-4-12(10)19-11/h1-6H |
| InChIKey | VMQHOWOVMXIROE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C3=C(S2)C=CC(=C3)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |