For research use only. Not for therapeutic Use.
2,7-Dimethyl-1,8-naphthyridine is a heterocyclic compound featuring a naphthyridine core with methyl groups at the 2 and 7 positions. It is used in pharmaceutical research and organic synthesis, particularly in the development of bioactive molecules and coordination chemistry. The structure’s nitrogen-containing ring system makes it a valuable building block for designing ligands, catalysts, and therapeutic agents. Its reactivity allows for various chemical modifications, supporting advancements in medicinal chemistry, drug discovery, and the development of functional materials.
CAS Number | 14903-78-7 |
Synonyms | 2,7-Dimethyl-1,8-naphthyridine |
Molecular Formula | C10H10N2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2,7-dimethyl-1,8-naphthyridine |
InChI | InChI=1S/C10H10N2/c1-7-3-5-9-6-4-8(2)12-10(9)11-7/h3-6H,1-2H3 |
InChIKey | IVOPVBBXMWVCHV-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=CC(=N2)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |