For research use only. Not for therapeutic Use.
2,7-Dichloro-9H-xanthene-9-carboxylic acid(CAT: L000141) is a compound of significance in organic chemistry and material science. Its action mechanism involves participating in various chemical reactions, making it valuable for the synthesis of complex organic molecules. In material chemistry, it plays a pivotal role in the development of specialized materials, particularly in the creation of dyes and pigments.
| CAS Number | 188027-95-4 |
| Molecular Formula | C14H8Cl2O3 |
| Purity | ≥95% |
| IUPAC Name | 2,7-dichloro-9H-xanthene-9-carboxylic acid |
| InChI | InChI=1S/C14H8Cl2O3/c15-7-1-3-11-9(5-7)13(14(17)18)10-6-8(16)2-4-12(10)19-11/h1-6,13H,(H,17,18) |
| InChIKey | OCUBZGSJBOWQLF-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |