For research use only. Not for therapeutic Use.
2,6-Dimethylbenzo[d]oxazol-5-ol (Cat.No:L003758) is a vital chemical compound with diverse applications in pharmaceutical and materials science. Its unique structure incorporates a benzo[d]oxazole ring, imparting distinct reactivity. This compound serves as a crucial intermediate in the synthesis of specialized organic molecules with various industrial and medicinal uses.
| CAS Number | 66481-29-6 |
| Molecular Formula | C9H9NO2 |
| Purity | ≥95% |
| IUPAC Name | 2,6-dimethyl-1,3-benzoxazol-5-ol |
| InChI | InChI=1S/C9H9NO2/c1-5-3-9-7(4-8(5)11)10-6(2)12-9/h3-4,11H,1-2H3 |
| InChIKey | ZASHPHLRHARKFC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1O)N=C(O2)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |