For research use only. Not for therapeutic Use.
2,6-Dichloromethylpyridine hydrochloride (CAS 55422-79-2) is used as an intermediate in organic syntheses.
| CAS Number | 55422-79-2 |
| Synonyms | 2,6-Bis(chloromethyl)pyridine, HCl |
| Molecular Formula | C7H8Cl3N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,6-bis(chloromethyl)pyridine;hydrochloride |
| InChI | InChI=1S/C7H7Cl2N.ClH/c8-4-6-2-1-3-7(5-9)10-6;/h1-3H,4-5H2;1H |
| InChIKey | FGBGOYAWNBDXCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)CCl)CCl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |