For research use only. Not for therapeutic Use.
2,6-Dichloroisonicotinic Acid (Cat No.:R020847) is a chemical compound with the molecular formula C6H3Cl2NO2. It is a derivative of isonicotinic acid, featuring two chlorine atoms substituted at positions 2 and 6 of the pyridine ring. This compound is used in various applications, including as a building block in the synthesis of pharmaceuticals and agrochemicals. Its modified pyridine structure enhances its reactivity and versatility in chemical reactions, supporting its role in creating diverse molecules. 2,6-Dichloroisonicotinic Acid’s importance lies in its contribution to the development of functional compounds with potential applications across industries.
CAS Number | 5398-44-7 |
Synonyms | 2,6-Dichloro-4-pyridinecarboxylic Acid; CGA 41396; NSC 4466 |
Molecular Formula | C6H3Cl2NO2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2,6-dichloropyridine-4-carboxylic acid |
InChI | InChI=1S/C6H3Cl2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11) |
InChIKey | SQSYNRCXIZHKAI-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1Cl)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |