For research use only. Not for therapeutic Use.
2,6-Dichloro-7-deazapurine (Cat No.: R004817) is a halogenated purine analog in which the nitrogen atom at position 7 of the purine ring is replaced with a carbon, forming a 7-deazapurine core. Chlorine atoms at positions 2 and 6 enhance its reactivity for further chemical modification, particularly in nucleophilic substitution reactions. This compound is widely used as a building block in the synthesis of modified nucleosides and nucleotides, especially in antiviral and anticancer drug research targeting nucleic acid metabolism and enzyme inhibition.
| CAS Number | 90213-66-4 |
| Synonyms | 2,4-Dichloro-1H-pyrrolo[2,3-d]pyrimidine |
| Molecular Formula | C6H3Cl2N3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-1-2-9-5(3)11-6(8)10-4/h1-2H,(H,9,10,11) |
| InChIKey | GHXBPCSSQOKKGB-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=NC(=N2)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |