For research use only. Not for therapeutic Use.
2,6-Dichloro-4-nitropyridine(Cat No.:R047042)is a halogenated nitropyridine derivative characterized by chlorine atoms at the 2 and 6 positions and a nitro group at the 4 position of the pyridine ring. This electron-deficient aromatic compound is highly reactive toward nucleophilic aromatic substitution, making it a valuable intermediate in the synthesis of agrochemicals, pharmaceuticals, and advanced materials. Its nitro and chloro substituents enhance electrophilicity, facilitating selective functionalization of the pyridine core. 2,6-Dichloro-4-nitropyridine is also used in heterocyclic chemistry for building complex structures and exploring biologically active compound development.
CAS Number | 25194-01-8 |
Synonyms | 2,6-Dichloro-4-nitro-pyridine; |
Molecular Formula | C5H2Cl2N2O2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2,6-dichloro-4-nitropyridine |
InChI | InChI=1S/C5H2Cl2N2O2/c6-4-1-3(9(10)11)2-5(7)8-4/h1-2H |
InChIKey | BZYQSSVTQJTUDD-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1Cl)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |