For research use only. Not for therapeutic Use.
2,6-Dichloro-3-hydroxybenzaldehyde(CAT: L000208) is a significant compound in organic chemistry, particularly in the synthesis of pharmaceutical and organic molecules. This compound serves as a versatile building block for creating various organic intermediates and pharmaceutical agents. Its unique chemical structure, featuring both hydroxyl and chloro groups, allows for specific modifications, making it an important component in the development of complex molecules.
| CAS Number | 56962-14-2 |
| Molecular Formula | C7H4Cl2O2 |
| Purity | ≥95% |
| IUPAC Name | 2,6-dichloro-3-hydroxybenzaldehyde |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-1-2-6(11)7(9)4(5)3-10/h1-3,11H |
| InChIKey | JDTZZOXWEJEADB-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |