2,6-Dibromo-3,4,5-trimethylaniline (Cat.No:L003908) is a significant chemical compound with diverse applications in synthesis and research. Its unique structure, featuring bromine and methyl groups, imparts specialized reactivity and properties. This compound serves as a crucial intermediate in the preparation of complex organic molecules with applications in pharmaceutical and chemical industries.
Catalog Number | L003908 |
CAS Number | 68818-73-5 |
Molecular Formula | C9H11Br2N |
Purity | ≥95% |
IUPAC Name | 2,6-dibromo-3,4,5-trimethylaniline |
InChI | InChI=1S/C9H11Br2N/c1-4-5(2)7(10)9(12)8(11)6(4)3/h12H2,1-3H3 |
InChIKey | MWKUZGOLAYCHFG-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1C)Br)N)Br)C |