For research use only. Not for therapeutic Use.
2,6-Diaminopyridine(Cat No.:R042847)is an aromatic organic compound featuring a pyridine ring substituted with two amino groups at the 2 and 6 positions. It appears as a white to light yellow crystalline solid and is highly soluble in water and polar solvents. This compound is primarily used as an intermediate in the synthesis of pharmaceuticals, dyes, and polymers. In medical research, 2,6-diaminopyridine has been explored for its potential to enhance neurotransmitter release and improve neuromuscular transmission, especially in treating Lambert-Eaton myasthenic syndrome. Its nucleophilic amine groups make it valuable in heterocyclic and coordination chemistry.
| CAS Number | 141-86-6 |
| Synonyms | 2,6-Pyridinediamine;?2,6-Diamino-pyridine; DAP; DAP (amine); NSC 1921; NSC 403346 |
| Molecular Formula | C5H7N3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | pyridine-2,6-diamine |
| InChI | InChI=1S/C5H7N3/c6-4-2-1-3-5(7)8-4/h1-3H,(H4,6,7,8) |
| InChIKey | VHNQIURBCCNWDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |