For research use only. Not for therapeutic Use.
2,6-Di-tert-butylpyridine (Cat No.: R025772) is a sterically hindered pyridine derivative known for its strong basicity and excellent selectivity as a non-nucleophilic base. The bulky tert-butyl groups at the 2 and 6 positions shield the nitrogen atom, preventing it from coordinating with metal centers or participating in unwanted side reactions. It is widely used in organic synthesis, particularly in acid scavenging, catalysis, and reactions requiring proton abstraction without nucleophilic interference. Its stability and selectivity make it valuable in both academic and industrial chemistry.
| CAS Number | 585-48-8 |
| Synonyms | 2,6-Bis(1,1-dimethylethyl)pyridine; NSC 175805 |
| Molecular Formula | C13H21N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,6-ditert-butylpyridine |
| InChI | InChI=1S/C13H21N/c1-12(2,3)10-8-7-9-11(14-10)13(4,5)6/h7-9H,1-6H3 |
| InChIKey | UWKQJZCTQGMHKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=CC=C1)C(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |