For research use only. Not for therapeutic Use.
2,6-Di-tert-butylaniline(Cat No.:M155281) is a chemical compound with the molecular formula C14H23N. It consists of an aniline group (an amino group attached to a benzene ring) substituted with two tert-butyl groups at the 2 and 6 positions. This compound is used as a hindered amine light stabilizer (HALS) in plastics and polymers to prevent degradation caused by exposure to ultraviolet (UV) light. The tert-butyl groups sterically hinder the amino group, making it less reactive and more effective at scavenging free radicals produced by UV light, thus extending the lifespan and preserving the appearance of the plastic or polymer.
| CAS Number | 2909-83-3 |
| Molecular Formula | C14H23N |
| Purity | ≥95% |
| IUPAC Name | 2,6-ditert-butylaniline |
| InChI | InChI=1S/C14H23N/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6/h7-9H,15H2,1-6H3 |
| InChIKey | RZSUJIUTUGMZPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)C(C)(C)C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |