For research use only. Not for therapeutic Use.
2,6-Di (2-thienyl) naphthalene (Cat. No: M349546) is a heterocyclic compound that can be used as a chemical intermediate for drug preparation in the fine chemical industry, mainly for scientific research.
| Molecular Formula | C18H12S2 |
| Purity | ≥95% |
| IUPAC Name | 2-(6-thiophen-2-ylnaphthalen-2-yl)thiophene |
| InChI | InChI=1S/C18H12S2/c1-3-17(19-9-1)15-7-5-14-12-16(8-6-13(14)11-15)18-4-2-10-20-18/h1-12H |
| InChIKey | IKMLLWOVDAPSOG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC3=C(C=C2)C=C(C=C3)C4=CC=CS4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
