Home
>
Catalysts and Ligands>Chiral nitrogen ligands> 2,6-Bis((S)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine
For research use only. Not for therapeutic Use.
2,6-Bis((S)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine (Cat.No:L003389) is a crucial chiral ligand in asymmetric synthesis. Its unique structure imparts exceptional stereochemical control in various chemical transformations, making it indispensable in the production of pharmaceuticals and fine chemicals.
| CAS Number | 189014-95-7 |
| Molecular Formula | C13H15N3O2 |
| Purity | ≥95% |
| IUPAC Name | (4S)-4-methyl-2-[6-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
| InChI | InChI=1S/C13H15N3O2/c1-8-6-17-12(14-8)10-4-3-5-11(16-10)13-15-9(2)7-18-13/h3-5,8-9H,6-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | UHXIDHCQNRFIHV-IUCAKERBSA-N |
| SMILES | C[C@H]1COC(=N1)C2=NC(=CC=C2)C3=N[C@H](CO3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |