For research use only. Not for therapeutic Use.
2,6-Bis(4,5-dihydrooxazol-2-yl)pyridine(CAT: L029106) is a versatile chelating ligand commonly used in coordination chemistry, organometallic catalysis, and asymmetric synthesis. Featuring two oxazoline rings attached to a pyridine core, this ligand offers multiple coordination sites, allowing it to form stable complexes with various transition metals. Its structure is ideal for facilitating enantioselective transformations, making it popular in applications such as asymmetric hydrogenation and cross-coupling reactions. The electron-donating properties of the oxazoline groups enhance the stability and reactivity of metal-ligand complexes, positioning 2,6-Bis(4,5-dihydrooxazol-2-yl)pyridine as a valuable tool in synthetic chemistry, particularly for developing enantioselective catalytic systems.
CAS Number | 165125-95-1 |
Molecular Formula | C11H11N3O2 |
Purity | ≥95% |
IUPAC Name | 2-[6-(4,5-dihydro-1,3-oxazol-2-yl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C11H11N3O2/c1-2-8(10-12-4-6-15-10)14-9(3-1)11-13-5-7-16-11/h1-3H,4-7H2 |
InChIKey | YOCRKHKJFCWTHG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |