For research use only. Not for therapeutic Use.
2,5-Divinylbenzene-1,4-diamine (Cat.No:L003928) is a vital compound in organic synthesis. Its unique structure, featuring divinyl substituents and a benzene-1,4-diamine core, imparts distinctive reactivity. This compound is utilized as a crucial building block in the creation of specialized molecules with applications in pharmaceutical and chemical research.
| CAS Number | 1631999-89-7 |
| Molecular Formula | C10H12N2 |
| Purity | ≥95% |
| IUPAC Name | 2,5-bis(ethenyl)benzene-1,4-diamine |
| InChI | InChI=1S/C10H12N2/c1-3-7-5-10(12)8(4-2)6-9(7)11/h3-6H,1-2,11-12H2 |
| InChIKey | ACXJHSWQLRWWMJ-UHFFFAOYSA-N |
| SMILES | C=CC1=CC(=C(C=C1N)C=C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |