For research use only. Not for therapeutic Use.
2,5-Dimethoxy-4-(ethylthio)phenethylamine hydrochloride (Cat No.: R010470), commonly known as 2C-T-2 hydrochloride, is a synthetic psychedelic compound belonging to the 2C family of phenethylamines. It features methoxy groups at the 2 and 5 positions and an ethylthio substituent at the 4-position on the aromatic ring. The hydrochloride salt form enhances solubility and stability. This compound acts primarily as a serotonin receptor agonist and is known for its psychoactive effects. It is used in psychopharmacological research but is regulated or controlled in many jurisdictions.
| CAS Number | 681160-71-4 |
| Synonyms | 4-(Ethylthio)-2,5-dimethoxybenzeneethanamine Hydrochloride;?4-Ethylthio-2,5-dimethoxyphenethylamine Hydrochloride;?2C-T2; |
| Molecular Formula | C12H20ClNO2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(4-ethylsulfanyl-2,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChI | InChI=1S/C12H19NO2S.ClH/c1-4-16-12-8-10(14-2)9(5-6-13)7-11(12)15-3;/h7-8H,4-6,13H2,1-3H3;1H |
| InChIKey | SMKRCPGGWNAUJG-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C=C(C(=C1)OC)CCN)OC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
