For research use only. Not for therapeutic Use.
2,5-Dihydroxy-p-benzenediacetic acid is an organic compound with the molecular formula C₁₀H₁₂O₄. It features a benzenedicarboxylic acid structure with hydroxyl groups at the 2 and 5 positions. This compound is known for its chelating properties, allowing it to form complexes with metal ions, which is useful in various applications, including medicine and environmental science. Its ability to bind metals makes it relevant in studies of metal ion transport and detoxification processes, as well as in the synthesis of functional materials.
CAS Number | 5488-16-4 |
Molecular Formula | C10H10O6 |
Purity | ≥95% |
IUPAC Name | 2-[4-(carboxymethyl)-2,5-dihydroxyphenyl]acetic acid |
InChI | InChI=1S/C10H10O6/c11-7-1-5(3-9(13)14)8(12)2-6(7)4-10(15)16/h1-2,11-12H,3-4H2,(H,13,14)(H,15,16) |
InChIKey | MCLKERLHVBEZIW-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1O)CC(=O)O)O)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |