For research use only. Not for therapeutic Use.
2,5-Diethynylbenzene-1,4-diamine (Cat.No:L003819) is a pivotal compound in organic synthesis. Its unique structure, featuring ethynyl groups and a benzene diamine core, imparts distinctive reactivity. This compound serves as a crucial building block in the creation of specialized molecules with applications in pharmaceutical and materials research.
CAS Number | 1141727-54-9 |
Molecular Formula | C10H8N2 |
Purity | ≥95% |
IUPAC Name | 2,5-diethynylbenzene-1,4-diamine |
InChI | InChI=1S/C10H8N2/c1-3-7-5-10(12)8(4-2)6-9(7)11/h1-2,5-6H,11-12H2 |
InChIKey | VBLDDPRXGITDQU-UHFFFAOYSA-N |
SMILES | C#CC1=CC(=C(C=C1N)C#C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |