2/',5/'-Dideoxyadenosine - CAS 6698-26-6

2/’,5/’-Dideoxyadenosine(CAT: I011421) is a synthetic nucleoside analog that lacks a hydroxyl group at the 3′ position of the ribose sugar, which is essential for the formation of the phosphodiester bond required for DNA and RNA synthesis. 2′,5′-Dideoxyadenosine is phosphorylated by cellular kinases to its triphosphate form, which competes with the natural nucleotide adenosine triphosphate (ATP) for incorporation into viral DNA during viral replication. This property has led to its use in research and the development of pharmaceuticals for the treatment of viral infections, such as hepatitis B and HIV.

Catalog Number: I011421

CAS Number: 6698-26-6

Molecular Formula: C₁₀H₁₃N₅O₂

Molecular Weight:235.25

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.

Synonym

Synonyms	2/’,5/’-dideoxy-adenosine

Property

Molecular Formula:	C₁₀H₁₃N₅O₂
Molecular Weight	235.25
Target:	Adenylate cyclase
Solubility	Soluble in DMSO
Purity	≥95%
Storage	Store at -20°C
MDL	MFCD00210904

Computed Descriptor

InChI	InChI=1S/C10H13N5O2/c1-5-6(16)2-7(17-5)15-4-14-8-9(11)12-3-13-10(8)15/h3-7,16H,2H2,1H3,(H2,11,12,13)/t5-,6+,7-/m1/s1
InChIKey	FFHPXOJTVQDVMO-DSYKOEDSSA-N
SMILES	CC1C(CC(O1)N2C=NC3=C2N=CN=C3N)O