For research use only. Not for therapeutic Use.
2,5-Dichlorophenol is a halogenated aromatic compound widely used in industrial applications, including as an intermediate in the synthesis of agrochemicals, pharmaceuticals, and dyes. It is also employed in the production of herbicides and fungicides. With two chlorine atoms positioned at the 2- and 5-positions on the phenol ring, 2,5-Dichlorophenol exhibits moderate toxicity and environmental persistence, necessitating careful handling and disposal. Its chemical structure makes it useful in studies of chemical reactivity and environmental fate.
| CAS Number | 583-78-8 |
| Synonyms | NSC 6296 |
| Molecular Formula | C6H4Cl2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,5-dichlorophenol |
| InChI | InChI=1S/C6H4Cl2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H |
| InChIKey | RANCECPPZPIPNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |