For research use only. Not for therapeutic Use.
2,5-Dibromothiophene-3-carbaldehyde (Cat.No:M047674) is a chemical compound used as an intermediate in organic synthesis. It contains a thiophene ring with bromine substituents and an aldehyde functional group. This compound is valued for its utility in the preparation of various organic molecules and pharmaceutical intermediates.
| CAS Number | 1193-69-7 |
| Molecular Formula | C5H2Br2OS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,5-dibromothiophene-3-carbaldehyde |
| InChI | InChI=1S/C5H2Br2OS/c6-4-1-3(2-8)5(7)9-4/h1-2H |
| InChIKey | GBJBDOWMZMXKCD-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C=O)Br)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
