For research use only. Not for therapeutic Use.
2,5-Diaminobenzoic acid dihydrochloride(Cat No.:L023407)is a versatile compound used in pharmaceutical and chemical research. Featuring a benzoic acid core with amino groups at the 2- and 5-positions, this compound is typically provided as a dihydrochloride salt, enhancing its solubility and stability. It serves as an important intermediate in the synthesis of various bioactive molecules, including dyes, drugs, and polymers. Its dual amino groups allow for diverse chemical modifications, making it valuable in developing therapeutic agents, especially in areas related to metabolic and inflammatory conditions.
CAS Number | 1158259-09-6 |
Molecular Formula | C7H10Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | 2,5-diaminobenzoic acid;dihydrochloride |
InChI | InChI=1S/C7H8N2O2.2ClH/c8-4-1-2-6(9)5(3-4)7(10)11;;/h1-3H,8-9H2,(H,10,11);2*1H |
InChIKey | DYYLTSSEVZXCSY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1N)C(=O)O)N.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |