For research use only. Not for therapeutic Use.
2,5-Diamino-2,5-cyclohexadiene-1,4-dione (Cat No.: M050053), also known as diaminobenzoquinone, is an aromatic organic compound featuring two amino groups and a quinonoid structure. It serves as a versatile intermediate in organic synthesis, particularly in the preparation of dyes, pigments, and redox-active materials. Its conjugated diene and carbonyl functionality make it valuable in coordination chemistry and electronic applications. Additionally, it plays a role in the development of functional polymers and conductive materials due to its redox properties and structural similarity to para-benzoquinone derivatives.
CAS Number | 1521-06-8 |
Molecular Formula | C6H6N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,5-diaminocyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C6H6N2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H,7-8H2 |
InChIKey | VUVVIURXJWHENR-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)C=C(C1=O)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |