For research use only. Not for therapeutic Use.
2,5-Bis(heptyloxy)terephthalaldehyde (Cat.No:L003778) is a significant chemical compound with versatile applications in materials science. Its unique structure, featuring terephthalaldehyde units linked by heptyloxy chains, imparts specialized properties. This compound serves as a crucial building block in the synthesis of advanced materials, particularly in the development of organic semiconductors and liquid crystals.
CAS Number | 206762-48-3 |
Molecular Formula | C22H34O4 |
Purity | ≥95% |
IUPAC Name | 2,5-diheptoxyterephthalaldehyde |
InChI | InChI=1S/C22H34O4/c1-3-5-7-9-11-13-25-21-15-20(18-24)22(16-19(21)17-23)26-14-12-10-8-6-4-2/h15-18H,3-14H2,1-2H3 |
InChIKey | ASYHPQABVPFLJM-UHFFFAOYSA-N |
SMILES | CCCCCCCOC1=CC(=C(C=C1C=O)OCCCCCCC)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |