For research use only. Not for therapeutic Use.
2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine is a triazine-based compound with three carboxyphenyl groups, commonly used in materials science, coordination chemistry, and organic synthesis. Its rigid, symmetrical structure makes it a valuable building block for constructing metal-organic frameworks (MOFs), polymers, and supramolecular assemblies. The presence of carboxyl groups allows for strong coordination with metal ions, contributing to the design of advanced materials. This compound is also utilized in developing catalysts and sensors, supporting research in both chemical and material sciences.
| CAS Number | 61414-16-2 |
| Synonyms | 2,4,6-Tris(4-carboxyphenyl)-1,3,5-triazine; 4,4′,4”-(1,3,5-Triazine-2,4,6-triyl)tribenzoic acid; 4-[4,6-bis(4-carboxyphenyl)-1,3,5-triazin-2-yl]benzoic acid |
| Molecular Formula | C24H15N3O6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-[4,6-bis(4-carboxyphenyl)-1,3,5-triazin-2-yl]benzoic acid |
| InChI | InChI=1S/C24H15N3O6/c28-22(29)16-7-1-13(2-8-16)19-25-20(14-3-9-17(10-4-14)23(30)31)27-21(26-19)15-5-11-18(12-6-15)24(32)33/h1-12H,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | MSFXUHUYNSYIDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |