For research use only. Not for therapeutic Use.
2,4,6-Trimethylstyrene(Cat No.:L005916)is an aromatic hydrocarbon featuring a styrene backbone with three methyl groups substituted at the 2, 4, and 6 positions of the phenyl ring. This compound exhibits enhanced hydrophobicity and steric bulk due to its methyl substituents, influencing its polymerization behavior and reactivity. It is commonly used as a monomer or comonomer in the production of specialty polymers, resins, and advanced materials. The vinyl group allows for radical polymerization, while the substituted aromatic ring imparts thermal stability and rigidity, making it suitable for coatings, adhesives, and high-performance polymer applications.
| CAS Number | 769-25-5 |
| Molecular Formula | C11H14 |
| Purity | ≥95% |
| IUPAC Name | 2-ethenyl-1,3,5-trimethylbenzene |
| InChI | InChI=1S/C11H14/c1-5-11-9(3)6-8(2)7-10(11)4/h5-7H,1H2,2-4H3 |
| InChIKey | PDELBHCVXBSVPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C=C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |