For research use only. Not for therapeutic Use.
2,4,5-Trifluorobenzonitrile(Cat No.:L027088)is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzene ring with three fluorine atoms at the 2, 4, and 5 positions, and a nitrile group at the 1-position. This combination of fluorine atoms provides unique electronic properties, enhancing the compound’s reactivity and stability. It is particularly valuable as an intermediate in the synthesis of complex molecules, including pharmaceuticals and agrochemicals. The nitrile group allows for versatile chemical modifications, making this compound essential for researchers focused on drug discovery and advanced material science.
CAS Number | 98349-22-5 |
Molecular Formula | C7H2F3N |
Purity | ≥95% |
IUPAC Name | 2,4,5-trifluorobenzonitrile |
InChI | InChI=1S/C7H2F3N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H |
InChIKey | DLKNOGQOOZFICZ-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1F)F)F)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |