Home
>
Chemical Reagents>Organometallic Reagents> 2,4-diphenyl-6-[3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1'-biphenyl]-3-yl]-1,3,5-Triazine
2,4-diphenyl-6-[3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1'-biphenyl]-3-yl]-1,3,5-Triazine
For research use only. Not for therapeutic Use.
2,4-diphenyl-6-[3′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1′-biphenyl]-3-yl]-1,3,5-Triazine(Cat No.:L007231), is a complex chemical compound used in organic synthesis and medicinal chemistry research. Featuring a triazine core, it contains multiple phenyl groups and a biphenyl boron-containing moiety. This compound is significant in the design of new materials and pharmaceuticals. Its intricate structure allows for diverse reactivity, making it valuable for creating complex organic molecules. Researchers employ this compound as a key intermediate, enabling the development of unique bioactive compounds, and contributing significantly to drug discovery efforts and advancements in synthetic methodologies.
| CAS Number | 1802232-96-7 |
| Molecular Formula | C33H30BN3O2 |
| Purity | ≥95% |
| IUPAC Name | 2,4-diphenyl-6-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1,3,5-triazine |
| InChI | InChI=1S/C33H30BN3O2/c1-32(2)33(3,4)39-34(38-32)28-20-12-18-26(22-28)25-17-11-19-27(21-25)31-36-29(23-13-7-5-8-14-23)35-30(37-31)24-15-9-6-10-16-24/h5-22H,1-4H3 |
| InChIKey | DXRSARWSFXFONX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CC(=CC=C3)C4=NC(=NC(=N4)C5=CC=CC=C5)C6=CC=CC=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |