For research use only. Not for therapeutic Use.
2,4-Dimethoxybenzene-1-thiol(CAT: M132115) is a high-purity aromatic compound featuring two methoxy groups and a thiol functionality on a benzene ring. This versatile molecule is widely utilized in organic synthesis, particularly in the development of advanced materials, pharmaceuticals, and agrochemicals. The thiol group enables participation in various chemical transformations, including thiol-ene reactions and disulfide bond formation, while the methoxy groups enhance its electronic properties. With reliable stability and consistent quality, 2,4-Dimethoxybenzene-1-thiol is a valuable reagent for research in medicinal chemistry, material science, and precision-oriented synthetic applications.
| CAS Number | 18906-37-1 |
| Synonyms | 2,4-dimethoxybenzene-1-thiol |
| Molecular Formula | C8H10O2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,4-dimethoxybenzenethiol |
| InChI | InChI=1S/C8H10O2S/c1-9-6-3-4-8(11)7(5-6)10-2/h3-5,11H,1-2H3 |
| InChIKey | FZHTUELUUNCLRZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)S)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |