For research use only. Not for therapeutic Use.
2,4-Diiodo-6-nitroaniline(Cat No.:L007621), is a chemical compound featuring an aniline core substituted with two iodine atoms at the 2 and 4 positions and a nitro group at the 6 position. This specific molecular structure is significant in organic synthesis and materials science. Researchers utilize it as a valuable intermediate for the creation of complex organic molecules and polymers. Its unique arrangement of iodine and nitro groups offers opportunities for various chemical modifications, enabling the development of specialized compounds for research purposes, contributing to advancements in both organic chemistry and materials science research.
CAS Number | 116529-49-8 |
Molecular Formula | C6H4I2N2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2,4-diiodo-6-nitroaniline |
InChI | InChI=1S/C6H4I2N2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 |
InChIKey | MVWFXGGTHGLHSU-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)I)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |