For research use only. Not for therapeutic Use.
2,4-Dihydroxybenzoic acid(Cat No.:R070480)is a dihydroxybenzoic acid derivative commonly used in pharmaceutical and chemical research. This compound, featuring hydroxyl groups at the 2- and 4-positions on the benzoic acid ring, is a key intermediate in the synthesis of various bioactive molecules, including antioxidants and anti-inflammatory agents. Its unique structure allows for versatile chemical modifications, making it valuable in developing drugs, dyes, and other fine chemicals. The reactivity and stability of 2,4-Dihydroxybenzoic acid make it an essential tool for researchers focused on advancing medicinal chemistry and material science.
CAS Number | 89-86-1 |
Synonyms | b-Resorcylic acid |
Molecular Formula | C7H6O4 |
Purity | ≥95% |
IUPAC Name | 2,4-dihydroxybenzoic acid |
InChI | InChI=1S/C7H6O4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H,(H,10,11) |
InChIKey | UIAFKZKHHVMJGS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |