For research use only. Not for therapeutic Use.
2,4-Dihydroxybenzene-1,3,5-tricarbaldehyde (Cat.No:L003839) is a pivotal compound in organic synthesis. Its distinctive tricarbaldehyde structure imparts unique reactivity, making it a valuable precursor for specialized molecules. This compound finds applications in the development of advanced materials, particularly in the field of coordination chemistry.
| CAS Number | 58343-11-6 |
| Molecular Formula | C9H6O5 |
| Purity | ≥95% |
| IUPAC Name | 2,4-dihydroxybenzene-1,3,5-tricarbaldehyde |
| InChI | InChI=1S/C9H6O5/c10-2-5-1-6(3-11)9(14)7(4-12)8(5)13/h1-4,13-14H |
| InChIKey | CEPNDKRJQPJVNM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1C=O)O)C=O)O)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
