For research use only. Not for therapeutic Use.
2,4-Difluororesorcinol（Cat No.:M040954）is a halogenated derivative of resorcinol, featuring fluorine atoms substituted at the 2 and 4 positions of the aromatic ring. This compound is valued for its electron-withdrawing fluorine groups, which influence reactivity and stability, making it useful in organic synthesis and medicinal chemistry. It serves as an intermediate in the development of pharmaceuticals, agrochemicals, and specialty polymers. Its hydroxyl groups enable participation in hydrogen bonding and functionalization reactions, while fluorination can enhance bioavailability and metabolic resistance in drug design applications.
| CAS Number | 195136-71-1 |
| Synonyms | 2,4-difluorobenzene-1,3-diol |
| Molecular Formula | C6H4F2O2 |
| Purity | ≥95% |
| IUPAC Name | 2,4-difluorobenzene-1,3-diol |
| InChI | InChI=1S/C6H4F2O2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H |
| InChIKey | IBNBFQFUGXNAKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)F)O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
