For research use only. Not for therapeutic Use.
2′,4′-Difluoropropiophenone(Cat No.:L047156)is an aromatic ketone used in pharmaceutical research and organic synthesis. The molecule features a propiophenone backbone with fluorine atoms substituted at the 2′ and 4′ positions on the aromatic ring, providing unique electronic properties. This compound is valuable as an intermediate in the synthesis of biologically active molecules, particularly in the development of pharmaceuticals and agrochemicals. Its ketone group allows for versatile chemical reactions, including nucleophilic additions and condensations, making it essential for researchers focused on drug discovery and the development of advanced synthetic materials.
CAS Number | 85068-30-0 |
Molecular Formula | C9H8F2O |
Purity | ≥95% |
IUPAC Name | 1-(2,4-difluorophenyl)propan-1-one |
InChI | InChI=1S/C9H8F2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
InChIKey | UZWOADNMVRRYDE-UHFFFAOYSA-N |
SMILES | CCC(=O)C1=C(C=C(C=C1)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |